About butanedioate;propanedioate
butanedioate;propanedioate (PubChem CID 18423363) has the molecular formula C7H6O8-4
and a molecular weight of 218.12 g/mol. Its IUPAC name is butanedioate;propanedioate.
Molecular Properties
| Compound Name | butanedioate;propanedioate |
| PubChem CID | 18423363 |
| Molecular Formula | C7H6O8-4 |
| Molecular Weight | 218.12 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | butanedioate;propanedioate |
| SMILES | O=C([O-])CC(=O)[O-].O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/C4H6O4.C3H4O4/c5-3(6)1-2-4(7)8;4-2(5)1-3(6)7/h1-2H2,(H,5,6)(H,7,8);1H2,(H,4,5)(H,6,7)/p-4 |
| InChIKey | OAOXPQKIXSVSRH-UHFFFAOYSA-J |
| XLogP | -5.86 |
| TPSA | 160.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.12 |
| LogP ≤ 5 | -5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanedioate;propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioate;propanedioate?
The IUPAC name of butanedioate;propanedioate (CID 18423363) is butanedioate;propanedioate.
What is the SMILES notation for butanedioate;propanedioate?
The canonical SMILES for butanedioate;propanedioate is O=C([O-])CC(=O)[O-].O=C([O-])CCC(=O)[O-].
What is the InChIKey of butanedioate;propanedioate?
The InChIKey is OAOXPQKIXSVSRH-UHFFFAOYSA-J. The full InChI is InChI=1S/C4H6O4.C3H4O4/c5-3(6)1-2-4(7)8;4-2(5)1-3(6)7/h1-2H2,(H,5,6)(H,7,8);1H2,(H,4,5)(H,6,7)/p-4.
What are the key properties of butanedioate;propanedioate?
butanedioate;propanedioate has a molecular weight of 218.12 g/mol, XLogP of -5.86, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioate;propanedioate is sourced from PubChem (CID 18423363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).