About disodium;butanedioate;methanol
disodium;butanedioate;methanol (PubChem CID 160588999) has the molecular formula C5H8Na2O5
and a molecular weight of 194.09 g/mol. Its IUPAC name is disodium;butanedioate;methanol.
Molecular Properties
| Compound Name | disodium;butanedioate;methanol |
| PubChem CID | 160588999 |
| Molecular Formula | C5H8Na2O5 |
| Molecular Weight | 194.09 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | disodium;butanedioate;methanol |
| SMILES | CO.O=C([O-])CCC(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O4.CH4O.2Na/c5-3(6)1-2-4(7)8;1-2;;/h1-2H2,(H,5,6)(H,7,8);2H,1H3;;/q;;2*+1/p-2 |
| InChIKey | BFTQVDPWHBWXSN-UHFFFAOYSA-L |
| XLogP | -9.12 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.09 |
| LogP ≤ 5 | -9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;butanedioate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;butanedioate;methanol?
The IUPAC name of disodium;butanedioate;methanol (CID 160588999) is disodium;butanedioate;methanol.
What is the SMILES notation for disodium;butanedioate;methanol?
The canonical SMILES for disodium;butanedioate;methanol is CO.O=C([O-])CCC(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;butanedioate;methanol?
The InChIKey is BFTQVDPWHBWXSN-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O4.CH4O.2Na/c5-3(6)1-2-4(7)8;1-2;;/h1-2H2,(H,5,6)(H,7,8);2H,1H3;;/q;;2*+1/p-2.
What are the key properties of disodium;butanedioate;methanol?
disodium;butanedioate;methanol has a molecular weight of 194.09 g/mol, XLogP of -9.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;butanedioate;methanol is sourced from PubChem (CID 160588999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).