About copper bis(4-oxopentanoate)
copper bis(4-oxopentanoate) (PubChem CID 86599724) has the molecular formula C10H14CuO6
and a molecular weight of 293.76 g/mol. Its IUPAC name is copper bis(4-oxopentanoate).
Molecular Properties
| Compound Name | copper bis(4-oxopentanoate) |
| PubChem CID | 86599724 |
| Molecular Formula | C10H14CuO6 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | copper bis(4-oxopentanoate) |
| SMILES | CC(=O)CCC(=O)[O-].CC(=O)CCC(=O)[O-].[Cu+2] |
| InChI | InChI=1S/2C5H8O3.Cu/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | SKZVZJFDEFVSLM-UHFFFAOYSA-L |
| XLogP | -1.79 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper bis(4-oxopentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(4-oxopentanoate)?
The IUPAC name of copper bis(4-oxopentanoate) (CID 86599724) is copper bis(4-oxopentanoate).
What is the SMILES notation for copper bis(4-oxopentanoate)?
The canonical SMILES for copper bis(4-oxopentanoate) is CC(=O)CCC(=O)[O-].CC(=O)CCC(=O)[O-].[Cu+2].
What is the InChIKey of copper bis(4-oxopentanoate)?
The InChIKey is SKZVZJFDEFVSLM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H8O3.Cu/c2*1-4(6)2-3-5(7)8;/h2*2-3H2,1H3,(H,7,8);/q;;+2/p-2.
What are the key properties of copper bis(4-oxopentanoate)?
copper bis(4-oxopentanoate) has a molecular weight of 293.76 g/mol, XLogP of -1.79, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(4-oxopentanoate) is sourced from PubChem (CID 86599724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).