C10H21NO4 — CID 87096007
2-hydroxyethyl(trimethyl)azanium;4-oxopentanoate (PubChem CID 87096007) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;4-oxopentanoate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;4-oxopentanoate |
|---|---|
| PubChem CID | 87096007 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)[O-].C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C5H8O3/c1-6(2,3)4-5-7;1-4(6)2-3-5(7)8/h7H,4-5H2,1-3H3;2-3H2,1H3,(H,7,8)/q+1;/p-1 |
| InChIKey | OCXYLGBKDFYKKY-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|