About butanedioate;2-hydroxyethyl(trimethyl)azanium
butanedioate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 87766528) has the molecular formula C9H18NO5-
and a molecular weight of 220.24 g/mol. Its IUPAC name is butanedioate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | butanedioate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 87766528 |
| Molecular Formula | C9H18NO5- |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | butanedioate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/C5H14NO.C4H6O4/c1-6(2,3)4-5-7;5-3(6)1-2-4(7)8/h7H,4-5H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/q+1;/p-2 |
| InChIKey | LXMXJLNOLAGNQG-UHFFFAOYSA-L |
| XLogP | -3.05 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanedioate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of butanedioate;2-hydroxyethyl(trimethyl)azanium (CID 87766528) is butanedioate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for butanedioate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for butanedioate;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.O=C([O-])CCC(=O)[O-].
What is the InChIKey of butanedioate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is LXMXJLNOLAGNQG-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H14NO.C4H6O4/c1-6(2,3)4-5-7;5-3(6)1-2-4(7)8/h7H,4-5H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/q+1;/p-2.
What are the key properties of butanedioate;2-hydroxyethyl(trimethyl)azanium?
butanedioate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 220.24 g/mol, XLogP of -3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 87766528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).