C9H20INO5 — CID 21127322
2-hydroxyethyl(trimethyl)azanium;4-hydroxy-4-oxobutanoate;hydroiodide (PubChem CID 21127322) has the molecular formula C9H20INO5 and a molecular weight of 349.17 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;4-hydroxy-4-oxobutanoate;hydroiodide.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;4-hydroxy-4-oxobutanoate;hydroiodide |
|---|---|
| PubChem CID | 21127322 |
| Molecular Formula | C9H20INO5 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;4-hydroxy-4-oxobutanoate;hydroiodide |
| SMILES | C[N+](C)(C)CCO.I.O=C([O-])CCC(=O)O |
| InChI | InChI=1S/C5H14NO.C4H6O4.HI/c1-6(2,3)4-5-7;5-3(6)1-2-4(7)8;/h7H,4-5H2,1-3H3;1-2H2,(H,5,6)(H,7,8);1H/q+1;;/p-1 |
| InChIKey | PNIPZKZLNASHHJ-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|