C15H29N3O9 — CID 141327657
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 141327657) has the molecular formula C15H29N3O9 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 141327657 |
| Molecular Formula | C15H29N3O9 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C([O-])CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C10H16N2O8.C5H14NO/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-6(2,3)4-5-7/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | XHVKRXOQFOIUHX-UHFFFAOYSA-M |
| XLogP | -3.72 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|