C10H20FeN4O8 — CID 138400041
azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(2+) (PubChem CID 138400041) has the molecular formula C10H20FeN4O8 and a molecular weight of 380.14 g/mol. Its IUPAC name is azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(2+).
| Compound Name | azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(2+) |
|---|---|
| PubChem CID | 138400041 |
| Molecular Formula | C10H20FeN4O8 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | azane;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(2+) |
| SMILES | N.N.O=C([O-])CN(CCN(CC(=O)O)CC(=O)O)CC(=O)[O-].[Fe+2] |
| InChI | InChI=1S/C10H16N2O8.Fe.2H3N/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;2*1H3/q;+2;;/p-2 |
| InChIKey | DAXSNIGIAFNVEY-UHFFFAOYSA-L |
| XLogP | -4.42 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|