C10H17N3O8Sr — CID 139894770
azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate (PubChem CID 139894770) has the molecular formula C10H17N3O8Sr and a molecular weight of 394.88 g/mol. Its IUPAC name is azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate.
| Compound Name | azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
|---|---|
| PubChem CID | 139894770 |
| Molecular Formula | C10H17N3O8Sr |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)[O-].[NH4+].[Sr+2] |
| InChI | InChI=1S/C10H16N2O8.H3N.Sr/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3;/q;;+2/p-2 |
| InChIKey | BHYBJHGOPXKIOC-UHFFFAOYSA-L |
| XLogP | -6.08 |
| TPSA | 200.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |