About azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate
azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate (PubChem CID 139894770) has the molecular formula C10H17N3O8Sr
and a molecular weight of 394.88 g/mol. Its IUPAC name is azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate.
Molecular Properties
| Compound Name | azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| PubChem CID | 139894770 |
| Molecular Formula | C10H17N3O8Sr |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)[O-].[NH4+].[Sr+2] |
| InChI | InChI=1S/C10H16N2O8.H3N.Sr/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3;/q;;+2/p-2 |
| InChIKey | BHYBJHGOPXKIOC-UHFFFAOYSA-L |
| XLogP | -6.08 |
| TPSA | 200.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | -6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate?
The IUPAC name of azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate (CID 139894770) is azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate.
What is the SMILES notation for azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate?
The canonical SMILES for azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate is O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)[O-].[NH4+].[Sr+2].
What is the InChIKey of azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate?
The InChIKey is BHYBJHGOPXKIOC-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H16N2O8.H3N.Sr/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H3;/q;;+2/p-2.
What are the key properties of azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate?
azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate has a molecular weight of 394.88 g/mol, XLogP of -6.08, 11 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;strontium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate is sourced from PubChem (CID 139894770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).