C10H14CdN2O8-2 — CID 118985497
cadmium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate (PubChem CID 118985497) has the molecular formula C10H14CdN2O8-2 and a molecular weight of 402.64 g/mol. Its IUPAC name is cadmium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate.
| Compound Name | cadmium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate |
|---|---|
| PubChem CID | 118985497 |
| Molecular Formula | C10H14CdN2O8-2 |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | cadmium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)O.[Cd] |
| InChI | InChI=1S/C10H16N2O8.Cd/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/p-2 |
| InChIKey | MMYOQIOTVVMDEZ-UHFFFAOYSA-L |
| XLogP | -4.74 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |