C10H14N2O8Sn — CID 101283521
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tin(2+) (PubChem CID 101283521) has the molecular formula C10H14N2O8Sn and a molecular weight of 408.94 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tin(2+).
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tin(2+) |
|---|---|
| PubChem CID | 101283521 |
| Molecular Formula | C10H14N2O8Sn |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tin(2+) |
| SMILES | O=C([O-])CN(CCN(CC(=O)O)CC(=O)O)CC(=O)[O-].[Sn+2] |
| InChI | InChI=1S/C10H16N2O8.Sn/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+2/p-2 |
| InChIKey | PSVPMYJXSAHZOM-UHFFFAOYSA-L |
| XLogP | -5.12 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |