C26H60N6O8 — CID 22338696
2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(tetramethylazanium) (PubChem CID 22338696) has the molecular formula C26H60N6O8 and a molecular weight of 584.80 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(tetramethylazanium).
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(tetramethylazanium) |
|---|---|
| PubChem CID | 22338696 |
| Molecular Formula | C26H60N6O8 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.45 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrakis(tetramethylazanium) |
| SMILES | C[N+](C)(C)C.C[N+](C)(C)C.C[N+](C)(C)C.C[N+](C)(C)C.O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C10H16N2O8.4C4H12N/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;4*1-5(2,3)4/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);4*1-4H3/q;4*+1/p-4 |
| InChIKey | NXWWYFKWUDEAJH-UHFFFAOYSA-J |
| XLogP | -6.12 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | -6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|