C10H12N2O8Pd-4 — CID 15436232
2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;palladium (PubChem CID 15436232) has the molecular formula C10H12N2O8Pd-4 and a molecular weight of 394.63 g/mol. Its IUPAC name is 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;palladium.
| Compound Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;palladium |
|---|---|
| PubChem CID | 15436232 |
| Molecular Formula | C10H12N2O8Pd-4 |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;palladium |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Pd] |
| InChI | InChI=1S/C10H16N2O8.Pd/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/p-4 |
| InChIKey | KZWJHHMKQZVFAN-UHFFFAOYSA-J |
| XLogP | -7.41 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | -7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |