C10H12N2Na7O8+3 — CID 23616700
heptasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate (PubChem CID 23616700) has the molecular formula C10H12N2Na7O8+3 and a molecular weight of 449.14 g/mol. Its IUPAC name is heptasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate.
| Compound Name | heptasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
|---|---|
| PubChem CID | 23616700 |
| Molecular Formula | C10H12N2Na7O8+3 |
| Molecular Weight | 449.14 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | heptasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.7Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;;;;/q;7*+1/p-4 |
| InChIKey | DHFYOKGWIVHZDY-UHFFFAOYSA-J |
| XLogP | -28.38 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.14 |
| LogP ≤ 5 | -28.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |