C10H14N2Na2O8 — CID 18401221
disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydron (PubChem CID 18401221) has the molecular formula C10H14N2Na2O8 and a molecular weight of 336.21 g/mol. Its IUPAC name is disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydron.
| Compound Name | disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydron |
|---|---|
| PubChem CID | 18401221 |
| Molecular Formula | C10H14N2Na2O8 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;hydron |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[H+].[H+].[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.2Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+1/p-2 |
| InChIKey | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| XLogP | -13.18 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | -13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |