C10H12FeKN2O8 — CID 172907632
potassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) (PubChem CID 172907632) has the molecular formula C10H12FeKN2O8 and a molecular weight of 383.16 g/mol. Its IUPAC name is potassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+).
| Compound Name | potassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
|---|---|
| PubChem CID | 172907632 |
| Molecular Formula | C10H12FeKN2O8 |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | potassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| SMILES | O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Fe+3].[K+] |
| InChI | InChI=1S/C10H16N2O8.Fe.K/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;+3;+1/p-4 |
| InChIKey | ZXSCVYQKZLXHBR-UHFFFAOYSA-J |
| XLogP | -10.41 |
| TPSA | 167.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | -10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|