C17H35NO5 — CID 159467086
2-hydroxyethyl(trimethyl)azanium;12-hydroxy-12-oxododecanoate (PubChem CID 159467086) has the molecular formula C17H35NO5 and a molecular weight of 333.47 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;12-hydroxy-12-oxododecanoate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;12-hydroxy-12-oxododecanoate |
|---|---|
| PubChem CID | 159467086 |
| Molecular Formula | C17H35NO5 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;12-hydroxy-12-oxododecanoate |
| SMILES | C[N+](C)(C)CCO.O=C([O-])CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H22O4.C5H14NO/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;1-6(2,3)4-5-7/h1-10H2,(H,13,14)(H,15,16);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | LVIAGASBRRPSSJ-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|