About carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium
carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 173335741) has the molecular formula C7H17NO7
and a molecular weight of 227.21 g/mol. Its IUPAC name is carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 173335741 |
| Molecular Formula | C7H17NO7 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.O=C(O)O.O=C([O-])O |
| InChI | InChI=1S/C5H14NO.2CH2O3/c1-6(2,3)4-5-7;2*2-1(3)4/h7H,4-5H2,1-3H3;2*(H2,2,3,4)/q+1;;/p-1 |
| InChIKey | HQUNPSWHTQCKMT-UHFFFAOYSA-M |
| XLogP | -1.21 |
| TPSA | 138.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium (CID 173335741) is carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.O=C(O)O.O=C([O-])O.
What is the InChIKey of carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is HQUNPSWHTQCKMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14NO.2CH2O3/c1-6(2,3)4-5-7;2*2-1(3)4/h7H,4-5H2,1-3H3;2*(H2,2,3,4)/q+1;;/p-1.
What are the key properties of carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium?
carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 227.21 g/mol, XLogP of -1.21, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;hydrogen carbonate;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 173335741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).