C8H19NO4 — CID 10313496
2-hydroxyethyl(trimethyl)azanium;2-hydroxypropanoate (PubChem CID 10313496) has the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. Its IUPAC name is 2-hydroxyethyl(trimethyl)azanium;2-hydroxypropanoate.
| Compound Name | 2-hydroxyethyl(trimethyl)azanium;2-hydroxypropanoate |
|---|---|
| PubChem CID | 10313496 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-hydroxyethyl(trimethyl)azanium;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C3H6O3/c1-6(2,3)4-5-7;1-2(4)3(5)6/h7H,4-5H2,1-3H3;2,4H,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | MIFGTXFTLQVWJW-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|