C8H21N2O3+ — CID 155059662
2-aminopropanoic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 155059662) has the molecular formula C8H21N2O3+ and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-aminopropanoic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 155059662 |
| Molecular Formula | C8H21N2O3+ |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2-aminopropanoic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC(N)C(=O)O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C3H7NO2/c1-6(2,3)4-5-7;1-2(4)3(5)6/h7H,4-5H2,1-3H3;2H,4H2,1H3,(H,5,6)/q+1; |
| InChIKey | CBVIHDFUVVTSLT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|