C8H20N2O4 — CID 87276262
(2S)-2-amino-3-hydroxypropanoate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 87276262) has the molecular formula C8H20N2O4 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | (2S)-2-amino-3-hydroxypropanoate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 87276262 |
| Molecular Formula | C8H20N2O4 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.N[C@@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C5H14NO.C3H7NO3/c1-6(2,3)4-5-7;4-2(1-5)3(6)7/h7H,4-5H2,1-3H3;2,5H,1,4H2,(H,6,7)/q+1;/p-1/t;2-/m.0/s1 |
| InChIKey | TWEQFZNNFJIALY-WNQIDUERSA-M |
| XLogP | -3.26 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|