C14H24N2O4 — CID 70307313
2-amino-3-(4-hydroxyphenyl)propanoate;2-hydroxyethyl(trimethyl)azanium (PubChem CID 70307313) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-amino-3-(4-hydroxyphenyl)propanoate;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-amino-3-(4-hydroxyphenyl)propanoate;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 70307313 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-amino-3-(4-hydroxyphenyl)propanoate;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.NC(Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO3.C5H14NO/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;1-6(2,3)4-5-7/h1-4,8,11H,5,10H2,(H,12,13);7H,4-5H2,1-3H3/q;+1/p-1 |
| InChIKey | GBPYHIVNACUDHQ-UHFFFAOYSA-M |
| XLogP | -1.30 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|