C14H22N3O2- — CID 143501847
2-amino-3-[4-(3,4-diaminopentyl)phenyl]propanoate (PubChem CID 143501847) has the molecular formula C14H22N3O2- and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-amino-3-[4-(3,4-diaminopentyl)phenyl]propanoate.
| Compound Name | 2-amino-3-[4-(3,4-diaminopentyl)phenyl]propanoate |
|---|---|
| PubChem CID | 143501847 |
| Molecular Formula | C14H22N3O2- |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-amino-3-[4-(3,4-diaminopentyl)phenyl]propanoate |
| SMILES | CC(N)C(N)CCc1ccc(CC(N)C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H23N3O2/c1-9(15)12(16)7-6-10-2-4-11(5-3-10)8-13(17)14(18)19/h2-5,9,12-13H,6-8,15-17H2,1H3,(H,18,19)/p-1 |
| InChIKey | JNKGLUBLVSMHLD-UHFFFAOYSA-M |
| XLogP | -1.09 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |