C19H30NNaO4 — CID 89052494
sodium;(2S)-2-amino-3-phenylpropanoate;decanoic acid (PubChem CID 89052494) has the molecular formula C19H30NNaO4 and a molecular weight of 359.44 g/mol. Its IUPAC name is sodium;(2S)-2-amino-3-phenylpropanoate;decanoic acid.
| Compound Name | sodium;(2S)-2-amino-3-phenylpropanoate;decanoic acid |
|---|---|
| PubChem CID | 89052494 |
| Molecular Formula | C19H30NNaO4 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | sodium;(2S)-2-amino-3-phenylpropanoate;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.N[C@@H](Cc1ccccc1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H20O2.C9H11NO2.Na/c1-2-3-4-5-6-7-8-9-10(11)12;10-8(9(11)12)6-7-4-2-1-3-5-7;/h2-9H2,1H3,(H,11,12);1-5,8H,6,10H2,(H,11,12);/q;;+1/p-1/t;8-;/m.0./s1 |
| InChIKey | PKQKMXCWAWONPR-JGUUTJLBSA-M |
| XLogP | -0.48 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|