About ethane;hexyl 2-amino-3-phenylpropanoate
ethane;hexyl 2-amino-3-phenylpropanoate (PubChem CID 162724773) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is ethane;hexyl 2-amino-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethane;hexyl 2-amino-3-phenylpropanoate |
| PubChem CID | 162724773 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | ethane;hexyl 2-amino-3-phenylpropanoate |
| SMILES | CC.CCCCCCOC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C15H23NO2.C2H6/c1-2-3-4-8-11-18-15(17)14(16)12-13-9-6-5-7-10-13;1-2/h5-7,9-10,14H,2-4,8,11-12,16H2,1H3;1-2H3 |
| InChIKey | GGRARWMFGDUVBA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;hexyl 2-amino-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexyl 2-amino-3-phenylpropanoate?
The IUPAC name of ethane;hexyl 2-amino-3-phenylpropanoate (CID 162724773) is ethane;hexyl 2-amino-3-phenylpropanoate.
What is the SMILES notation for ethane;hexyl 2-amino-3-phenylpropanoate?
The canonical SMILES for ethane;hexyl 2-amino-3-phenylpropanoate is CC.CCCCCCOC(=O)C(N)Cc1ccccc1.
What is the InChIKey of ethane;hexyl 2-amino-3-phenylpropanoate?
The InChIKey is GGRARWMFGDUVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2.C2H6/c1-2-3-4-8-11-18-15(17)14(16)12-13-9-6-5-7-10-13;1-2/h5-7,9-10,14H,2-4,8,11-12,16H2,1H3;1-2H3.
What are the key properties of ethane;hexyl 2-amino-3-phenylpropanoate?
ethane;hexyl 2-amino-3-phenylpropanoate has a molecular weight of 279.42 g/mol, XLogP of 3.71, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexyl 2-amino-3-phenylpropanoate is sourced from PubChem (CID 162724773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).