C13H17NO4 — CID 174208096
4-[(2R)-2-amino-3-phenylpropanoyl]oxybutanoic acid (PubChem CID 174208096) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-[(2R)-2-amino-3-phenylpropanoyl]oxybutanoic acid.
| Compound Name | 4-[(2R)-2-amino-3-phenylpropanoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 174208096 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(2R)-2-amino-3-phenylpropanoyl]oxybutanoic acid |
| SMILES | N[C@H](Cc1ccccc1)C(=O)OCCCC(=O)O |
| InChI | InChI=1S/C13H17NO4/c14-11(9-10-5-2-1-3-6-10)13(17)18-8-4-7-12(15)16/h1-3,5-6,11H,4,7-9,14H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | MEOWQRLFTXGTLF-LLVKDONJSA-N |
| XLogP | 0.96 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|