C15H21NO6 — CID 90108351
(2S)-2-amino-3-phenylpropanoic acid;hexanedioic acid (PubChem CID 90108351) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;hexanedioic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;hexanedioic acid |
|---|---|
| PubChem CID | 90108351 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;hexanedioic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H10O4/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-5(8)3-1-2-4-6(9)10/h1-5,8H,6,10H2,(H,11,12);1-4H2,(H,7,8)(H,9,10)/t8-;/m0./s1 |
| InChIKey | MZNAMGHHOQGUMR-QRPNPIFTSA-N |
| XLogP | 1.36 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|