C21H28N2O4 — CID 174613463
benzamide;pentyl 2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 174613463) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is benzamide;pentyl 2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | benzamide;pentyl 2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 174613463 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | benzamide;pentyl 2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCCCCOC(=O)C(N)Cc1ccc(O)cc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO3.C7H7NO/c1-2-3-4-9-18-14(17)13(15)10-11-5-7-12(16)8-6-11;8-7(9)6-4-2-1-3-5-6/h5-8,13,16H,2-4,9-10,15H2,1H3;1-5H,(H2,8,9) |
| InChIKey | FOGHUPZINZNTRV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|