C30H37NO5 — CID 16720426
8-(4-phenylmethoxyphenoxy)octyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate (PubChem CID 16720426) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 8-(4-phenylmethoxyphenoxy)octyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate.
| Compound Name | 8-(4-phenylmethoxyphenoxy)octyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 16720426 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 8-(4-phenylmethoxyphenoxy)octyl (2S)-2-amino-3-(4-hydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)OCCCCCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H37NO5/c31-29(22-24-12-14-26(32)15-13-24)30(33)35-21-9-4-2-1-3-8-20-34-27-16-18-28(19-17-27)36-23-25-10-6-5-7-11-25/h5-7,10-19,29,32H,1-4,8-9,20-23,31H2/t29-/m0/s1 |
| InChIKey | FXXJEMQRDVGDSU-LJAQVGFWSA-N |
| XLogP | 5.80 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|