C33H44INO5 — CID 85105364
[3-(4-hydroxyphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octoxy]propan-2-yl]-trimethylazanium iodide (PubChem CID 85105364) has the molecular formula C33H44INO5 and a molecular weight of 661.62 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octoxy]propan-2-yl]-trimethylazanium iodide.
| Compound Name | [3-(4-hydroxyphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octoxy]propan-2-yl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 85105364 |
| Molecular Formula | C33H44INO5 |
| Molecular Weight | 661.62 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | [3-(4-hydroxyphenyl)-1-oxo-1-[8-(4-phenylmethoxyphenoxy)octoxy]propan-2-yl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)C(Cc1ccc(O)cc1)C(=O)OCCCCCCCCOc1ccc(OCc2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C33H43NO5.HI/c1-34(2,3)32(25-27-15-17-29(35)18-16-27)33(36)38-24-12-7-5-4-6-11-23-37-30-19-21-31(22-20-30)39-26-28-13-9-8-10-14-28;/h8-10,13-22,32H,4-7,11-12,23-26H2,1-3H3;1H |
| InChIKey | NOXMGLBURYBJQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|