C35H47N2O5+ — CID 10233778
[1-[8-[4-[4-(dimethylamino)benzoyl]oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium (PubChem CID 10233778) has the molecular formula C35H47N2O5+ and a molecular weight of 575.77 g/mol. Its IUPAC name is [1-[8-[4-[4-(dimethylamino)benzoyl]oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium.
| Compound Name | [1-[8-[4-[4-(dimethylamino)benzoyl]oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 10233778 |
| Molecular Formula | C35H47N2O5+ |
| Molecular Weight | 575.77 g/mol |
| Exact Mass | 575.35 |
| IUPAC Name | [1-[8-[4-[4-(dimethylamino)benzoyl]oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium |
| SMILES | CN(C)c1ccc(C(=O)Oc2ccc(OCCCCCCCCOC(=O)C(Cc3ccccc3)[N+](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C35H47N2O5/c1-36(2)30-19-17-29(18-20-30)34(38)42-32-23-21-31(22-24-32)40-25-13-8-6-7-9-14-26-41-35(39)33(37(3,4)5)27-28-15-11-10-12-16-28/h10-12,15-24,33H,6-9,13-14,25-27H2,1-5H3/q+1 |
| InChIKey | XYWJLZKWXYAJPF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|