C35H44NO5+ — CID 10212055
trimethyl-[1-oxo-1-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octoxy]-3-phenylpropan-2-yl]azanium (PubChem CID 10212055) has the molecular formula C35H44NO5+ and a molecular weight of 558.74 g/mol. Its IUPAC name is trimethyl-[1-oxo-1-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octoxy]-3-phenylpropan-2-yl]azanium.
| Compound Name | trimethyl-[1-oxo-1-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octoxy]-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 10212055 |
| Molecular Formula | C35H44NO5+ |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | trimethyl-[1-oxo-1-[8-[(4-oxo-2-phenyl-2,3-dihydrochromen-6-yl)oxy]octoxy]-3-phenylpropan-2-yl]azanium |
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)OCCCCCCCCOc1ccc2c(c1)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C35H44NO5/c1-36(2,3)31(24-27-16-10-8-11-17-27)35(38)40-23-15-7-5-4-6-14-22-39-29-20-21-33-30(25-29)32(37)26-34(41-33)28-18-12-9-13-19-28/h8-13,16-21,25,31,34H,4-7,14-15,22-24,26H2,1-3H3/q+1 |
| InChIKey | HWTWIMYPKBPBHS-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|