C33H41N2O7+ — CID 10212219
trimethyl-[1-[8-[4-(4-nitrobenzoyl)oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 10212219) has the molecular formula C33H41N2O7+ and a molecular weight of 577.70 g/mol. Its IUPAC name is trimethyl-[1-[8-[4-(4-nitrobenzoyl)oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | trimethyl-[1-[8-[4-(4-nitrobenzoyl)oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 10212219 |
| Molecular Formula | C33H41N2O7+ |
| Molecular Weight | 577.70 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | trimethyl-[1-[8-[4-(4-nitrobenzoyl)oxyphenoxy]octoxy]-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)OCCCCCCCCOc1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C33H41N2O7/c1-35(2,3)31(25-26-13-9-8-10-14-26)33(37)41-24-12-7-5-4-6-11-23-40-29-19-21-30(22-20-29)42-32(36)27-15-17-28(18-16-27)34(38)39/h8-10,13-22,31H,4-7,11-12,23-25H2,1-3H3/q+1 |
| InChIKey | XFRDRUFVCVWHMM-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|