About 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate
3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate (PubChem CID 17137975) has the molecular formula C24H21NO7
and a molecular weight of 435.43 g/mol. Its IUPAC name is 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate.
Molecular Properties
| Compound Name | 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate |
| PubChem CID | 17137975 |
| Molecular Formula | C24H21NO7 |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Oc1ccc(C(=O)OCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO7/c26-23(17-31-21-14-10-20(11-15-21)25(28)29)32-22-12-8-19(9-13-22)24(27)30-16-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-15H,4,7,16-17H2 |
| InChIKey | XZBQSOUUGZLAML-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate?
The IUPAC name of 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate (CID 17137975) is 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate.
What is the SMILES notation for 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate?
The canonical SMILES for 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate is O=C(COc1ccc([N+](=O)[O-])cc1)Oc1ccc(C(=O)OCCCc2ccccc2)cc1.
What is the InChIKey of 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate?
The InChIKey is XZBQSOUUGZLAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21NO7/c26-23(17-31-21-14-10-20(11-15-21)25(28)29)32-22-12-8-19(9-13-22)24(27)30-16-4-7-18-5-2-1-3-6-18/h1-3,5-6,8-15H,4,7,16-17H2.
What are the key properties of 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate?
3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate has a molecular weight of 435.43 g/mol, XLogP of 4.37, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl 4-[2-(4-nitrophenoxy)acetyl]oxybenzoate is sourced from PubChem (CID 17137975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).