C24H22O4 — CID 17137945
[4-(3-phenylpropoxycarbonyl)phenyl] 3-methylbenzoate (PubChem CID 17137945) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is [4-(3-phenylpropoxycarbonyl)phenyl] 3-methylbenzoate.
| Compound Name | [4-(3-phenylpropoxycarbonyl)phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 17137945 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [4-(3-phenylpropoxycarbonyl)phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C(=O)OCCCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H22O4/c1-18-7-5-11-21(17-18)24(26)28-22-14-12-20(13-15-22)23(25)27-16-6-10-19-8-3-2-4-9-19/h2-5,7-9,11-15,17H,6,10,16H2,1H3 |
| InChIKey | IDOOFUAZCMJOHB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|