About 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate
2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate (PubChem CID 23185550) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate.
Molecular Properties
| Compound Name | 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate |
| PubChem CID | 23185550 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCCOC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H18O4/c1-13-5-3-7-15(11-13)17(19)21-9-10-22-18(20)16-8-4-6-14(2)12-16/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | MAYGRQPLNYUCFT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate?
The IUPAC name of 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate (CID 23185550) is 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate.
What is the SMILES notation for 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate?
The canonical SMILES for 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate is Cc1cccc(C(=O)OCCOC(=O)c2cccc(C)c2)c1.
What is the InChIKey of 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate?
The InChIKey is MAYGRQPLNYUCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-13-5-3-7-15(11-13)17(19)21-9-10-22-18(20)16-8-4-6-14(2)12-16/h3-8,11-12H,9-10H2,1-2H3.
What are the key properties of 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate?
2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate has a molecular weight of 298.34 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbenzoyl)oxyethyl 3-methylbenzoate is sourced from PubChem (CID 23185550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).