C24H24O4 — CID 175518678
(3-methylbenzoyl) 3-methylbenzenecarboperoxoate;1,2-xylene (PubChem CID 175518678) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3-methylbenzoyl) 3-methylbenzenecarboperoxoate;1,2-xylene.
| Compound Name | (3-methylbenzoyl) 3-methylbenzenecarboperoxoate;1,2-xylene |
|---|---|
| PubChem CID | 175518678 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (3-methylbenzoyl) 3-methylbenzenecarboperoxoate;1,2-xylene |
| SMILES | Cc1cccc(C(=O)OOC(=O)c2cccc(C)c2)c1.Cc1ccccc1C |
| InChI | InChI=1S/C16H14O4.C8H10/c1-11-5-3-7-13(9-11)15(17)19-20-16(18)14-8-4-6-12(2)10-14;1-7-5-3-4-6-8(7)2/h3-10H,1-2H3;3-6H,1-2H3 |
| InChIKey | NRSLDFXVBODNKI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|