About (3-methylbenzoyl)azanium
(3-methylbenzoyl)azanium (PubChem CID 153183849) has the molecular formula C8H10NO+
and a molecular weight of 136.17 g/mol. Its IUPAC name is (3-methylbenzoyl)azanium.
Molecular Properties
| Compound Name | (3-methylbenzoyl)azanium |
| PubChem CID | 153183849 |
| Molecular Formula | C8H10NO+ |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | (3-methylbenzoyl)azanium |
| SMILES | Cc1cccc(C([NH3+])=O)c1 |
| InChI | InChI=1S/C8H9NO/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H2,9,10)/p+1 |
| InChIKey | WGRPQCFFBRDZFV-UHFFFAOYSA-O |
| XLogP | 0.38 |
| TPSA | 44.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-methylbenzoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylbenzoyl)azanium?
The IUPAC name of (3-methylbenzoyl)azanium (CID 153183849) is (3-methylbenzoyl)azanium.
What is the SMILES notation for (3-methylbenzoyl)azanium?
The canonical SMILES for (3-methylbenzoyl)azanium is Cc1cccc(C([NH3+])=O)c1.
What is the InChIKey of (3-methylbenzoyl)azanium?
The InChIKey is WGRPQCFFBRDZFV-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H9NO/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H2,9,10)/p+1.
What are the key properties of (3-methylbenzoyl)azanium?
(3-methylbenzoyl)azanium has a molecular weight of 136.17 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylbenzoyl)azanium is sourced from PubChem (CID 153183849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).