C16H16S2 — CID 76563900
1,2-bis(3-methylphenyl)ethene-1,2-dithiol (PubChem CID 76563900) has the molecular formula C16H16S2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1,2-bis(3-methylphenyl)ethene-1,2-dithiol.
| Compound Name | 1,2-bis(3-methylphenyl)ethene-1,2-dithiol |
|---|---|
| PubChem CID | 76563900 |
| Molecular Formula | C16H16S2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1,2-bis(3-methylphenyl)ethene-1,2-dithiol |
| SMILES | Cc1cccc(C(S)=C(S)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C16H16S2/c1-11-5-3-7-13(9-11)15(17)16(18)14-8-4-6-12(2)10-14/h3-10,17-18H,1-2H3 |
| InChIKey | GPZYOSGGZHORMM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|