About 3-methylbenzenecarboselenoic Se-acid
3-methylbenzenecarboselenoic Se-acid (PubChem CID 166513879) has the molecular formula C8H8OSe
and a molecular weight of 199.11 g/mol. Its IUPAC name is 3-methylbenzenecarboselenoic Se-acid.
Molecular Properties
| Compound Name | 3-methylbenzenecarboselenoic Se-acid |
| PubChem CID | 166513879 |
| Molecular Formula | C8H8OSe |
| Molecular Weight | 199.11 g/mol |
| Exact Mass | 199.97 |
| IUPAC Name | 3-methylbenzenecarboselenoic Se-acid |
| SMILES | Cc1cccc(C(=O)[SeH])c1 |
| InChI | InChI=1S/C8H8OSe/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | QQDFHUJSCFSCKL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.11 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzenecarboselenoic Se-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzenecarboselenoic Se-acid?
The IUPAC name of 3-methylbenzenecarboselenoic Se-acid (CID 166513879) is 3-methylbenzenecarboselenoic Se-acid.
What is the SMILES notation for 3-methylbenzenecarboselenoic Se-acid?
The canonical SMILES for 3-methylbenzenecarboselenoic Se-acid is Cc1cccc(C(=O)[SeH])c1.
What is the InChIKey of 3-methylbenzenecarboselenoic Se-acid?
The InChIKey is QQDFHUJSCFSCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8OSe/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 3-methylbenzenecarboselenoic Se-acid?
3-methylbenzenecarboselenoic Se-acid has a molecular weight of 199.11 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzenecarboselenoic Se-acid is sourced from PubChem (CID 166513879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).