About 3-methylbenzoic acid;nitrous acid
3-methylbenzoic acid;nitrous acid (PubChem CID 175097452) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-methylbenzoic acid;nitrous acid.
Molecular Properties
| Compound Name | 3-methylbenzoic acid;nitrous acid |
| PubChem CID | 175097452 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-methylbenzoic acid;nitrous acid |
| SMILES | Cc1cccc(C(=O)O)c1.O=NO |
| InChI | InChI=1S/C8H8O2.HNO2/c1-6-3-2-4-7(5-6)8(9)10;2-1-3/h2-5H,1H3,(H,9,10);(H,2,3) |
| InChIKey | XEDAHHRFMAYKAY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzoic acid;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzoic acid;nitrous acid?
The IUPAC name of 3-methylbenzoic acid;nitrous acid (CID 175097452) is 3-methylbenzoic acid;nitrous acid.
What is the SMILES notation for 3-methylbenzoic acid;nitrous acid?
The canonical SMILES for 3-methylbenzoic acid;nitrous acid is Cc1cccc(C(=O)O)c1.O=NO.
What is the InChIKey of 3-methylbenzoic acid;nitrous acid?
The InChIKey is XEDAHHRFMAYKAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.HNO2/c1-6-3-2-4-7(5-6)8(9)10;2-1-3/h2-5H,1H3,(H,9,10);(H,2,3).
What are the key properties of 3-methylbenzoic acid;nitrous acid?
3-methylbenzoic acid;nitrous acid has a molecular weight of 183.16 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzoic acid;nitrous acid is sourced from PubChem (CID 175097452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).