About 3-methylbenzoic acid;1-methylpiperazine
3-methylbenzoic acid;1-methylpiperazine (PubChem CID 174580798) has the molecular formula C13H20N2O2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-methylbenzoic acid;1-methylpiperazine.
Molecular Properties
| Compound Name | 3-methylbenzoic acid;1-methylpiperazine |
| PubChem CID | 174580798 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-methylbenzoic acid;1-methylpiperazine |
| SMILES | CN1CCNCC1.Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H8O2.C5H12N2/c1-6-3-2-4-7(5-6)8(9)10;1-7-4-2-6-3-5-7/h2-5H,1H3,(H,9,10);6H,2-5H2,1H3 |
| InChIKey | OCWZRXRDTLBKKC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbenzoic acid;1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzoic acid;1-methylpiperazine?
The IUPAC name of 3-methylbenzoic acid;1-methylpiperazine (CID 174580798) is 3-methylbenzoic acid;1-methylpiperazine.
What is the SMILES notation for 3-methylbenzoic acid;1-methylpiperazine?
The canonical SMILES for 3-methylbenzoic acid;1-methylpiperazine is CN1CCNCC1.Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-methylbenzoic acid;1-methylpiperazine?
The InChIKey is OCWZRXRDTLBKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C5H12N2/c1-6-3-2-4-7(5-6)8(9)10;1-7-4-2-6-3-5-7/h2-5H,1H3,(H,9,10);6H,2-5H2,1H3.
What are the key properties of 3-methylbenzoic acid;1-methylpiperazine?
3-methylbenzoic acid;1-methylpiperazine has a molecular weight of 236.32 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzoic acid;1-methylpiperazine is sourced from PubChem (CID 174580798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).