About benzoic acid;1,4-dimethylpiperazine
benzoic acid;1,4-dimethylpiperazine (PubChem CID 166460840) has the molecular formula C13H20N2O2
and a molecular weight of 236.32 g/mol. Its IUPAC name is benzoic acid;1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | benzoic acid;1,4-dimethylpiperazine |
| PubChem CID | 166460840 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | benzoic acid;1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)CC1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C7H6O2.C6H14N2/c8-7(9)6-4-2-1-3-5-6;1-7-3-5-8(2)6-4-7/h1-5H,(H,8,9);3-6H2,1-2H3 |
| InChIKey | QGFIQJIEUSMPNK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;1,4-dimethylpiperazine?
The IUPAC name of benzoic acid;1,4-dimethylpiperazine (CID 166460840) is benzoic acid;1,4-dimethylpiperazine.
What is the SMILES notation for benzoic acid;1,4-dimethylpiperazine?
The canonical SMILES for benzoic acid;1,4-dimethylpiperazine is CN1CCN(C)CC1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;1,4-dimethylpiperazine?
The InChIKey is QGFIQJIEUSMPNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H14N2/c8-7(9)6-4-2-1-3-5-6;1-7-3-5-8(2)6-4-7/h1-5H,(H,8,9);3-6H2,1-2H3.
What are the key properties of benzoic acid;1,4-dimethylpiperazine?
benzoic acid;1,4-dimethylpiperazine has a molecular weight of 236.32 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;1,4-dimethylpiperazine is sourced from PubChem (CID 166460840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).