About Lithium benzoate, 99%
Lithium benzoate, 99% (PubChem CID 57451198) has the molecular formula C7H6LiO2
and a molecular weight of 129.06 g/mol.
Molecular Properties
| Compound Name | Lithium benzoate, 99% |
| PubChem CID | 57451198 |
| Molecular Formula | C7H6LiO2 |
| Molecular Weight | 129.06 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccccc1.[Li] |
| InChI | InChI=1S/C7H6O2.Li/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9); |
| InChIKey | FGQFWXDBSIBYLO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.06 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Lithium benzoate, 99% with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lithium benzoate, 99%?
The IUPAC name of Lithium benzoate, 99% (CID 57451198) is not available.
What is the SMILES notation for Lithium benzoate, 99%?
The canonical SMILES for Lithium benzoate, 99% is O=C(O)c1ccccc1.[Li].
What is the InChIKey of Lithium benzoate, 99%?
The InChIKey is FGQFWXDBSIBYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.Li/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);.
What are the key properties of Lithium benzoate, 99%?
Lithium benzoate, 99% has a molecular weight of 129.06 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Lithium benzoate, 99% is sourced from PubChem (CID 57451198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).