About benzoic acid;chromium
benzoic acid;chromium (PubChem CID 139063467) has the molecular formula C14H12CrO4
and a molecular weight of 296.24 g/mol. Its IUPAC name is benzoic acid;chromium.
Molecular Properties
| Compound Name | benzoic acid;chromium |
| PubChem CID | 139063467 |
| Molecular Formula | C14H12CrO4 |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | benzoic acid;chromium |
| SMILES | O=C(O)c1ccccc1.O=C(O)c1ccccc1.[Cr] |
| InChI | InChI=1S/2C7H6O2.Cr/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9); |
| InChIKey | WVUZCYHIRAQIAP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoic acid;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;chromium?
The IUPAC name of benzoic acid;chromium (CID 139063467) is benzoic acid;chromium.
What is the SMILES notation for benzoic acid;chromium?
The canonical SMILES for benzoic acid;chromium is O=C(O)c1ccccc1.O=C(O)c1ccccc1.[Cr].
What is the InChIKey of benzoic acid;chromium?
The InChIKey is WVUZCYHIRAQIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6O2.Cr/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H,8,9);.
What are the key properties of benzoic acid;chromium?
benzoic acid;chromium has a molecular weight of 296.24 g/mol, XLogP of 2.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;chromium is sourced from PubChem (CID 139063467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).