About benzoic acid;titanium;trihydrofluoride
benzoic acid;titanium;trihydrofluoride (PubChem CID 173018170) has the molecular formula C7H9F3O2Ti
and a molecular weight of 230.01 g/mol. Its IUPAC name is benzoic acid;titanium;trihydrofluoride.
Molecular Properties
| Compound Name | benzoic acid;titanium;trihydrofluoride |
| PubChem CID | 173018170 |
| Molecular Formula | C7H9F3O2Ti |
| Molecular Weight | 230.01 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | benzoic acid;titanium;trihydrofluoride |
| SMILES | F.F.F.O=C(O)c1ccccc1.[Ti] |
| InChI | InChI=1S/C7H6O2.3FH.Ti/c8-7(9)6-4-2-1-3-5-6;;;;/h1-5H,(H,8,9);3*1H; |
| InChIKey | YNQIJNGBDOPRQQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.01 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzoic acid;titanium;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;titanium;trihydrofluoride?
The IUPAC name of benzoic acid;titanium;trihydrofluoride (CID 173018170) is benzoic acid;titanium;trihydrofluoride.
What is the SMILES notation for benzoic acid;titanium;trihydrofluoride?
The canonical SMILES for benzoic acid;titanium;trihydrofluoride is F.F.F.O=C(O)c1ccccc1.[Ti].
What is the InChIKey of benzoic acid;titanium;trihydrofluoride?
The InChIKey is YNQIJNGBDOPRQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.3FH.Ti/c8-7(9)6-4-2-1-3-5-6;;;;/h1-5H,(H,8,9);3*1H;.
What are the key properties of benzoic acid;titanium;trihydrofluoride?
benzoic acid;titanium;trihydrofluoride has a molecular weight of 230.01 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;titanium;trihydrofluoride is sourced from PubChem (CID 173018170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).