About benzoic acid;copper;hydrate
benzoic acid;copper;hydrate (PubChem CID 174832637) has the molecular formula C7H8CuO3
and a molecular weight of 203.68 g/mol. Its IUPAC name is benzoic acid;copper;hydrate.
Molecular Properties
| Compound Name | benzoic acid;copper;hydrate |
| PubChem CID | 174832637 |
| Molecular Formula | C7H8CuO3 |
| Molecular Weight | 203.68 g/mol |
| Exact Mass | 202.98 |
| IUPAC Name | benzoic acid;copper;hydrate |
| SMILES | O.O=C(O)c1ccccc1.[Cu] |
| InChI | InChI=1S/C7H6O2.Cu.H2O/c8-7(9)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;1H2 |
| InChIKey | MSWOLSBZVWKKIL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.68 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzoic acid;copper;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;copper;hydrate?
The IUPAC name of benzoic acid;copper;hydrate (CID 174832637) is benzoic acid;copper;hydrate.
What is the SMILES notation for benzoic acid;copper;hydrate?
The canonical SMILES for benzoic acid;copper;hydrate is O.O=C(O)c1ccccc1.[Cu].
What is the InChIKey of benzoic acid;copper;hydrate?
The InChIKey is MSWOLSBZVWKKIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.Cu.H2O/c8-7(9)6-4-2-1-3-5-6;;/h1-5H,(H,8,9);;1H2.
What are the key properties of benzoic acid;copper;hydrate?
benzoic acid;copper;hydrate has a molecular weight of 203.68 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;copper;hydrate is sourced from PubChem (CID 174832637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).