About 3-methylbenzoic acid;3-methylideneoxiran-2-one
3-methylbenzoic acid;3-methylideneoxiran-2-one (PubChem CID 174975521) has the molecular formula C11H10O4
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-methylbenzoic acid;3-methylideneoxiran-2-one.
Molecular Properties
| Compound Name | 3-methylbenzoic acid;3-methylideneoxiran-2-one |
| PubChem CID | 174975521 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-methylbenzoic acid;3-methylideneoxiran-2-one |
| SMILES | C=C1OC1=O.Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C8H8O2.C3H2O2/c1-6-3-2-4-7(5-6)8(9)10;1-2-3(4)5-2/h2-5H,1H3,(H,9,10);1H2 |
| InChIKey | HGQKNSZXCZMCOG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzoic acid;3-methylideneoxiran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzoic acid;3-methylideneoxiran-2-one?
The IUPAC name of 3-methylbenzoic acid;3-methylideneoxiran-2-one (CID 174975521) is 3-methylbenzoic acid;3-methylideneoxiran-2-one.
What is the SMILES notation for 3-methylbenzoic acid;3-methylideneoxiran-2-one?
The canonical SMILES for 3-methylbenzoic acid;3-methylideneoxiran-2-one is C=C1OC1=O.Cc1cccc(C(=O)O)c1.
What is the InChIKey of 3-methylbenzoic acid;3-methylideneoxiran-2-one?
The InChIKey is HGQKNSZXCZMCOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C3H2O2/c1-6-3-2-4-7(5-6)8(9)10;1-2-3(4)5-2/h2-5H,1H3,(H,9,10);1H2.
What are the key properties of 3-methylbenzoic acid;3-methylideneoxiran-2-one?
3-methylbenzoic acid;3-methylideneoxiran-2-one has a molecular weight of 206.20 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzoic acid;3-methylideneoxiran-2-one is sourced from PubChem (CID 174975521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).