C15H22ClN3O2 — CID 119454797
N,3-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride (PubChem CID 119454797) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride.
| Compound Name | N,3-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119454797 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N,3-dimethyl-N-(2-oxo-2-piperazin-1-ylethyl)benzamide;hydrochloride |
| SMILES | Cc1cccc(C(=O)N(C)CC(=O)N2CCNCC2)c1.Cl |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-12-4-3-5-13(10-12)15(20)17(2)11-14(19)18-8-6-16-7-9-18;/h3-5,10,16H,6-9,11H2,1-2H3;1H |
| InChIKey | NWRDDPQVPGPODD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |