C15H22N4O2 — CID 43604055
1-methyl-3-(3-methylphenyl)-1-(2-oxo-2-piperazin-1-ylethyl)urea (PubChem CID 43604055) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-methyl-3-(3-methylphenyl)-1-(2-oxo-2-piperazin-1-ylethyl)urea.
| Compound Name | 1-methyl-3-(3-methylphenyl)-1-(2-oxo-2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 43604055 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-methyl-3-(3-methylphenyl)-1-(2-oxo-2-piperazin-1-ylethyl)urea |
| SMILES | Cc1cccc(NC(=O)N(C)CC(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C15H22N4O2/c1-12-4-3-5-13(10-12)17-15(21)18(2)11-14(20)19-8-6-16-7-9-19/h3-5,10,16H,6-9,11H2,1-2H3,(H,17,21) |
| InChIKey | PYSDTOWZOLMMPJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |